Fosaprepitant

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 416448532 | IUPAC_name = [3-{[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl] ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl}-5-oxo- 2H-1,2,4-triazol-1-yl]phosphonic acid | image = Fosaprepitant.svg | alt = Skeletal formula of fosaprepitant | width = 255 | image2 = Fosaprepitant-3D-spacefill.png | alt2 = Space-filling model of the fosaprepitant molecule | tradename = | Drugs.com = Multum Consumer Information | MedlinePlus = a604003 | licence_EU = yes | licence_US = Fosaprepitant | pregnancy_AU = | pregnancy_US = B | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = POM | legal_US = Rx-only | routes_of_administration = Intravenous | bioavailability = n/a | protein_bound = >95% (aprepitant) | metabolism = To aprepitant | elimination_half-life = 9 to 13 hours (aprepitant) | excretion = | IUPHAR_ligand = 7623 | CAS_number_Ref =  ☑Y | CAS_number = 172673-20-0 | CAS_supplemental =
265121-04-8 (dimeglumine) | ATC_prefix = A04 | ATC_suffix = AD12 | PubChem = 219090 | DrugBank_Ref =  ☒N | DrugBank = DB06717 | UNII_Ref =  ☒N | UNII = 6L8OF9XRDC | KEGG_Ref =  ☒N | KEGG = D06597 | ChEMBL_Ref =  ☒N | ChEMBL = 1199324 | ChEBI_Ref =  ☒N | ChEBI = 64321 | ChemSpiderID_Ref =  ☒N | ChemSpiderID = 189912 | C=23 | H=22 | F=7 | N=4 | O=6 | P=1 | molecular_weight = 614.406 g/mol | smiles = C[C@H](c1cc(cc(c1)C(F)(F)F)C(F)(F)F)O[C@@H]2[C@@H](N(CCO2)Cc3[nH]c(=O)n(n3)P(=O)(O)O)c4ccc(cc4)F | StdInChI_Ref =  ☒N | StdInChI = 1S/C23H22F7N4O6P/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)40-20-19(13-2-4-17(24)5-3-13)33(6-7-39-20)11-18-31-21(35)34(32-18)41(36,37)38/h2-5,8-10,12,19-20H,6-7,11H2,1H3,(H,31,32,35)(H2,36,37,38)/t12-,19+,20-/m1/s1 | StdInChIKey_Ref =  ☒N | StdInChIKey = BARDROPHSZEBKC-OITMNORJSA-N }}

Fosaprepitant (Emend for Injection (US), Ivemend (EU)) is an antiemetic drug, administered intravenously. It is a prodrug of aprepitant.

Fosaprepitant was developed by Merck & Co. and was approved by the United States Food and Drug Administration (FDA) on January 25, 2008[1] and by the European Medicines Agency (EMA) on January 11 of the same year.[2]

See also

References

  1. ↑ "Drugs.com, FDA Approves Emend (fosaprepitant dimeglumine) for Injection, Merck's New Intravenous Therapy, for Use in Combination with Other Antiemetics for Prevention of Nausea and Vomiting Caused by Chemotherapy". Retrieved 2008-03-15.
  2. ↑ "European Public Assessment Report for Ivemend (from the EMEA website)". Archived from the original on 2008-02-28. Retrieved 2008-03-15.


This article is issued from Wikipedia. The text is licensed under Creative Commons - Attribution - Sharealike. Additional terms may apply for the media files.