Rhamnetin
|
Names |
IUPAC name
2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxychromen-4-one |
Other names
7-Methylquercetin 7-Methoxyquercetin 7-O-Methylquercetin beta-Rhamnocitrin Quercetin 7-methyl ether |
Identifiers |
|
|
|
|
ChEBI |
|
ChemSpider |
|
ECHA InfoCard |
100.001.795 |
EC Number |
201-974-1 |
KEGG |
|
|
|
InChI=1S/C16H12O7/c1-22-8-5-11(19)13-12(6-8)23-16(15(21)14(13)20)7-2-3-9(17)10(18)4-7/h2-6,17-19,21H,1H3 NKey: JGUZGNYPMHHYRK-UHFFFAOYSA-N NInChI=1/C16H12O7/c1-22-8-5-11(19)13-12(6-8)23-16(15(21)14(13)20)7-2-3-9(17)10(18)4-7/h2-6,17-19,21H,1H3 Key: JGUZGNYPMHHYRK-UHFFFAOYAY
|
COC1=CC(=C2C(=C1)OC(=C(C2=O)O)C3=CC(=C(C=C3)O)O)O
|
Properties |
|
C16H12O7 |
Molar mass |
316.26 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
N verify (what is YN ?) |
Infobox references |
|
|
Rhamnetin is an O-methylated flavonol, a type of chemical compound. It can be isolated from cloves.
The structure of the molecule was discovered by Austrian chemist Josef Herzig (1853–1924).
Glycosides
Rhamnetin is the aglycone of xanthorhamnin.
Flavonols and their conjugates |
---|
Backbone | |
---|
Flavonols | Aglycones | |
---|
Conjugates | Glycosides of herbacetin | |
---|
Glycosides of kaempferol |
- Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
---|
Glycosides of myricetin | |
---|
Conjugates of quercetin | |
---|
|
---|
|
---|
O-Methylated flavonols | Aglycones | |
---|
Glycosides | of isorhamnetin |
- Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
---|
other |
- Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
---|
|
---|
|
---|
Derivative flavonols | Aglycones |
- Noricaritin
- Dihydronoricaritin
|
---|
Glycosides | |
---|
|
---|
Pyranoflavonols | |
---|
Furanoflavonols | |
---|
Semisynthetic | |
---|