Josamycin

{{Drugbox | Verifiedfields = changed | verifiedrevid = 477496532 | IUPAC_name = (2S,3S,4R,6S)-6-{[(2R,3S,4R,5R,6S)-6-{[(4R,5S,6S,7R,9R,10R,11E,13E,16R)-4-Acetoxy-10-hydroxy-5-methoxy-9,16-dimethyl-2-oxo-7-(2-oxoethyl)oxacyclohexadeca-11,13-dien-6-yl]oxy}-4-(dimethylamino)-5-hydro xy-2-methyltetrahydro-2H-pyran-3-yl]oxy}-4-hydroxy-2,4-dimethyltetrahydro-2H-pyran-3-yl 3-methylbutanoate | image = Josamycin.png | image2 = Josamycin ball-and-stick.png | tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | CAS_number_Ref =  ^Y | CAS_number = 16846-24-5 | ATC_prefix = J01 | ATC_suffix = FA07 | PubChem = 5282165 | DrugBank_Ref =  ^Y | DrugBank = DB01321 | ChemSpiderID_Ref =  ^Y | ChemSpiderID = 4445361 | UNII_Ref =  ^Y | UNII = HV13HFS217 | KEGG_Ref =  ^Y | KEGG = D01235 | ChEBI_Ref =  ^Y | ChEBI = 31739 | ChEMBL_Ref =  ^Y | ChEMBL = 224436 | PDB_ligand = | C=42 | H=69 | N=1 | O=15 | molecular_weight = 827.995 g/mol | smiles = C[C@@H]1C/C=C/C=C/[C@@H]([C@@H](C[C@@H]([C@@H]([C@H]([C@@H](CC(=O)O1)OC(=O)C)OC)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C)O[C@H]3C[C@@]([C@H]([C@@H](O3)C)OC(=O)CC(C)C)(C)O)N(C)C)O)CC=O)C)O | StdInChI_Ref =  ^Y | StdInChI = 1S/C42H69NO15/c1-23(2)19-32(47)56-40-27(6)53-34(22-42(40,8)50)57-37-26(5)54-41(36(49)35(37)43(9)10)58-38-29(17-18-44)20-24(3)30(46)16-14-12-13-15-25(4)52-33(48)21-31(39(38)51-11)55-28(7)45/h12-14,16,18,23-27,29-31,34-41,46,49-50H,15,17,19-22H2,1-11H3/b13-12+,16-14+/t24-,25-,26-,27+,29+,30+,31-,34+,35-,36-,37-,38+,39+,40+,41+,42-/m1/s1 | StdInChIKey_Ref =  ^Y | StdInChIKey = XJSFLOJWULLJQS-NGVXBBESSA-N }}

Josamycin is a macrolide antibiotic. It is synthesized from strains of Streptomyces narbonensis var. josamyceticus var. nova

Currently sold in various countries.

Brand examples are:

Europe: Josalid, Josacine, Iosalide, Josamina. Russia: Wilprafen (Вильпрафен). Japan: Josamy.

Adverse effects

There has been a case report of oedema of the feet.^[1]

References