2,3-Dihydroxycinnamic acid
![Chemical structure of 2,3-dihydroxycinnamic acid](../I/m/2%2C3-Dihydroxycinnamic_acid.svg.png) |
Names |
IUPAC name
(E)-3-(2,3-Dihydroxyphenyl)prop-2-enoic acid |
Other names
trans-2,3-Dihydroxycinnamate 3-(2,3-Dihydroxyphenyl)acrylic acid |
Identifiers |
|
|
|
|
ChemSpider |
|
|
|
InChI=1S/C9H8O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-5,10,13H,(H,11,12)/b5-4+ Key: SIUKXCMDYPYCLH-SNAWJCMRSA-N InChI=1/C9H8O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-5,10,13H,(H,11,12)/b5-4+ Key: SIUKXCMDYPYCLH-SNAWJCMRBO
|
c1cc(c(c(c1)O)O)/C=C/C(=O)O
|
Properties |
|
C9H8O4 |
Molar mass |
180.16 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references |
|
|
2,3-Dihydroxycinnamic acid is a hydroxycinnamic acid. It is an isomer of caffeic acid.
It is a metabolite found in human urine.[1]
References
- ↑ Heindl, A; Rau, O; Spiteller, G (1985). "Identification of aromatic dihydroxy acids in biological fluids". Biomedical Mass Spectrometry. 12 (2): 59–66. PMID 3158357.
|
---|
Aglycones | Precursor | |
---|
Monohydroxycinnamic acids (Coumaric acids) | |
---|
Dihydroxycinnamic acids | |
---|
Trihydroxycinnamic acids | |
---|
O-methylated forms | |
---|
others | |
---|
|
---|
Esters | glycoside-likes | Esters of caffeic acid with cyclitols | esters of quinic acid |
- Chlorogenic acid (3-caffeoylquinic acid)
- Cryptochlorogenic acid (4-O-caffeoylquinic acid)
- Neochlorogenic acid (5-O-Caffeoylquinic acid)
- Cynarine (1,5-dicaffeoylquinic acid)
- 3,4-dicaffeoylquinic acid
- 3,5-dicaffeoylquinic acid
|
---|
esters of shikimic acid | |
---|
|
---|
Glycosides | |
---|
|
---|
Tartaric acid esters | |
---|
Other esters with caffeic acid | |
---|
Caffeoyl phenylethanoid glycoside (CPG) |
- Echinacoside
- Calceolarioside A, B, C, F
- Chiritoside A, B, C
- Cistanoside A, B, C, D, E, F, G, H
- Conandroside
- Myconoside
- Pauoifloside
- Plantainoside A
- Plantamajoside
- Tubuloside B
- Verbascoside (Isoverbascoside, 2′-Acetylverbascoside)
|
---|
|
---|
Oligomeric forms | Dimers |
- Diferulic acids (DiFA) : 5,5′-Diferulic acid, 8-O-4′-Diferulic acid, 8,5′-Diferulic acid, 8,5′-DiFA (DC), 8,5′-DiFA (BF), 8,8′-Diferulic acid
|
---|
Trimers | |
---|
Tetramers | |
---|
|
---|
Conjugates with coenzyme A (CoA) | |
---|