Difucol
|
Names |
IUPAC name
2-(2,4,6-trihydroxyphenyl)benzene-1,3,5-triol |
Identifiers |
|
|
|
|
ChemSpider |
|
|
|
InChI=1S/C12H10O6/c13-5-1-7(15)11(8(16)2-5)12-9(17)3-6(14)4-10(12)18/h1-4,13-18H Key: PHDPNHJFOMABOA-UHFFFAOYSA-N InChI=1/C12H10O6/c13-5-1-7(15)11(8(16)2-5)12-9(17)3-6(14)4-10(12)18/h1-4,13-18H Key: PHDPNHJFOMABOA-UHFFFAOYAY
|
Oc1cc(O)cc(O)c1-c2c(O)cc(O)cc2O
|
Properties |
|
C12H10O6 |
Molar mass |
250.20 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references |
|
|
Difucol is a phlorotannin found in the brown algae Analipus japonicus and Cystophora retroflexa.
References
|
---|
Monomer | |
---|
Fucols | |
---|
Phlorethols |
- Diphlorethol and diphlorethol A
- Triphloroethol A
- Tetraphlorethol A, B, C and E
- Pentaphlorethol-B
- Hexaphlorethol-A
|
---|
Fucophlorethols |
- Fucophlorethol A and B
- Fucodiphlorethol A, D and G
- Fucotriphlorethol-B, G and H
- Fucotetraphlorethol-B, J and K
- Fucopentaphlorethol-E
- Bisfucotriphlorethol-A
- Bisfucotetraphlorethol-A
- Bisfucopentaphlorethol-A and B
- Bisfucoheptaphlorethol-A
- Difucophlorethol-A
- Difucofucotriphlorethol-A and B
- Difucofucotetraphlorethol-A
- Terfucopentaphlorethol-A
- Terfucohexaphlorethol-A and B
- Terfucoheptaphlorethol-A
|
---|
Fuhalols | |
---|
Isofuhalols | |
---|
Eckols | |
---|
Halogenated phlorotannins | Bromotriphlorethol A1 |
---|